C20H13N3O3S2 — CID 3459005
methyl 2-(1,3-benzothiazole-6-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3459005) has the molecular formula C20H13N3O3S2 and a molecular weight of 407.48 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazole-6-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(1,3-benzothiazole-6-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3459005 |
| Molecular Formula | C20H13N3O3S2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | methyl 2-(1,3-benzothiazole-6-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C20H13N3O3S2/c1-3-8-23-15-7-5-13(19(25)26-2)10-17(15)28-20(23)22-18(24)12-4-6-14-16(9-12)27-11-21-14/h1,4-7,9-11H,8H2,2H3/b22-20- |
| InChIKey | TVAKRWPTGJNULJ-XDOYNYLZSA-N |
| XLogP | 3.47 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|