C19H15N3O2S2 — CID 4619147
N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide (PubChem CID 4619147) has the molecular formula C19H15N3O2S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 4619147 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H15N3O2S2/c1-3-8-22-15-7-5-13(24-2)10-17(15)26-19(22)21-18(23)12-4-6-14-16(9-12)25-11-20-14/h3-7,9-11H,1,8H2,2H3/b21-19- |
| InChIKey | CUIMERFCCMDEHW-VZCXRCSSSA-N |
| XLogP | 4.25 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|