C19H15BrN2O3S — CID 5103871
methyl 2-(4-bromobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 5103871) has the molecular formula C19H15BrN2O3S and a molecular weight of 431.31 g/mol. Its IUPAC name is methyl 2-(4-bromobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(4-bromobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 5103871 |
| Molecular Formula | C19H15BrN2O3S |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | methyl 2-(4-bromobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(Br)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C19H15BrN2O3S/c1-3-10-22-15-9-6-13(18(24)25-2)11-16(15)26-19(22)21-17(23)12-4-7-14(20)8-5-12/h3-9,11H,1,10H2,2H3/b21-19- |
| InChIKey | NRZMPLQARQNADG-VZCXRCSSSA-N |
| XLogP | 4.18 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|