C19H14Cl2N2O3S — CID 3398396
methyl 2-(2,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3398396) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is methyl 2-(2,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(2,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3398396 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | methyl 2-(2,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(Cl)ccc2Cl)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-3-8-23-15-7-4-11(18(25)26-2)9-16(15)27-19(23)22-17(24)13-10-12(20)5-6-14(13)21/h3-7,9-10H,1,8H2,2H3/b22-19- |
| InChIKey | SXXRNIJCVYETJJ-QOCHGBHMSA-N |
| XLogP | 4.72 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|