C17H20N2O3S — CID 4216620
methyl 2-pentanoylimino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4216620) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl 2-pentanoylimino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-pentanoylimino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4216620 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 2-pentanoylimino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)CCCC)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C17H20N2O3S/c1-4-6-7-15(20)18-17-19(10-5-2)13-9-8-12(16(21)22-3)11-14(13)23-17/h5,8-9,11H,2,4,6-7,10H2,1,3H3/b18-17- |
| InChIKey | NASRZVMOCFVZQB-ZCXUNETKSA-N |
| XLogP | 3.29 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|