C21H20N2O5S2 — CID 41005097
methyl 2-(3-ethylsulfonylbenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 41005097) has the molecular formula C21H20N2O5S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 2-(3-ethylsulfonylbenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(3-ethylsulfonylbenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 41005097 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | methyl 2-(3-ethylsulfonylbenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(S(=O)(=O)CC)c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C21H20N2O5S2/c1-4-11-23-17-10-9-15(20(25)28-3)13-18(17)29-21(23)22-19(24)14-7-6-8-16(12-14)30(26,27)5-2/h4,6-10,12-13H,1,5,11H2,2-3H3/b22-21- |
| InChIKey | UFGLBGFYPFGJHL-DQRAZIAOSA-N |
| XLogP | 3.21 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|