C21H22N2O5S2 — CID 41005068
N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide (PubChem CID 41005068) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide.
| Compound Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 41005068 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(S(=O)(=O)CC)c2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C21H22N2O5S2/c1-5-12-23-18-16(27-3)10-11-17(28-4)19(18)29-21(23)22-20(24)14-8-7-9-15(13-14)30(25,26)6-2/h5,7-11,13H,1,6,12H2,2-4H3/b22-21- |
| InChIKey | ASMVGVBGLSWWBB-DQRAZIAOSA-N |
| XLogP | 3.44 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|