C22H26N2O6S2 — CID 42524492
N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-3-ethylsulfonylbenzamide (PubChem CID 42524492) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-3-ethylsulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-3-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 42524492 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-3-ethylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(S(=O)(=O)CC)c2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C22H26N2O6S2/c1-5-30-13-12-24-19-17(28-3)10-11-18(29-4)20(19)31-22(24)23-21(25)15-8-7-9-16(14-15)32(26,27)6-2/h7-11,14H,5-6,12-13H2,1-4H3/b23-22- |
| InChIKey | CISRAJHNRFNNNJ-FCQUAONHSA-N |
| XLogP | 3.29 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|