C20H24N2O5S2 — CID 16937204
(NZ)-N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 16937204) has the molecular formula C20H24N2O5S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is (NZ)-N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 16937204 |
| Molecular Formula | C20H24N2O5S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (NZ)-N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(C)cc2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C20H24N2O5S2/c1-5-27-13-12-22-18-16(25-3)10-11-17(26-4)19(18)28-20(22)21-29(23,24)15-8-6-14(2)7-9-15/h6-11H,5,12-13H2,1-4H3/b21-20- |
| InChIKey | AIYOAUJCZYTEBF-MRCUWXFGSA-N |
| XLogP | 3.35 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|