C18H19FN2O3S2 — CID 16937240
(NZ)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 16937240) has the molecular formula C18H19FN2O3S2 and a molecular weight of 394.49 g/mol. Its IUPAC name is (NZ)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 16937240 |
| Molecular Formula | C18H19FN2O3S2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (NZ)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(C)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C18H19FN2O3S2/c1-3-24-12-11-21-17-15(19)5-4-6-16(17)25-18(21)20-26(22,23)14-9-7-13(2)8-10-14/h4-10H,3,11-12H2,1-2H3/b20-18- |
| InChIKey | MNJVBSABNXYPHC-ZZEZOPTASA-N |
| XLogP | 3.48 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|