C21H23FN2O4S2 — CID 25406914
4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 25406914) has the molecular formula C21H23FN2O4S2 and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 25406914 |
| Molecular Formula | C21H23FN2O4S2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H23FN2O4S2/c1-2-28-14-13-24-20-17(22)10-6-11-18(20)29-21(24)23-19(25)12-7-15-30(26,27)16-8-4-3-5-9-16/h3-6,8-11H,2,7,12-15H2,1H3/b23-21- |
| InChIKey | UADNGHPCMLUVFX-LNVKXUELSA-N |
| XLogP | 3.56 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|