C21H21FN2O3S2 — CID 41087273
N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(4-methylphenyl)sulfonylbutanamide (PubChem CID 41087273) has the molecular formula C21H21FN2O3S2 and a molecular weight of 432.54 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 41087273 |
| Molecular Formula | C21H21FN2O3S2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(4-methylphenyl)sulfonylbutanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(C)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H21FN2O3S2/c1-3-13-24-20-17(22)6-4-7-18(20)28-21(24)23-19(25)8-5-14-29(26,27)16-11-9-15(2)10-12-16/h3-4,6-7,9-12H,1,5,8,13-14H2,2H3/b23-21- |
| InChIKey | WAPSWSZEIPAOFA-LNVKXUELSA-N |
| XLogP | 4.02 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|