C21H22N2O3S2 — CID 40699842
4-(4-methylphenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 40699842) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(4-methylphenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 40699842 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(C)cc2)sc2ccccc21 |
| InChI | InChI=1S/C21H22N2O3S2/c1-3-14-23-18-7-4-5-8-19(18)27-21(23)22-20(24)9-6-15-28(25,26)17-12-10-16(2)11-13-17/h3-5,7-8,10-13H,1,6,9,14-15H2,2H3/b22-21- |
| InChIKey | SKIYQVUEHVOFNG-DQRAZIAOSA-N |
| XLogP | 3.88 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|