C23H26N2O3S2 — CID 41087169
4-(benzenesulfonyl)-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 41087169) has the molecular formula C23H26N2O3S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 41087169 |
| Molecular Formula | C23H26N2O3S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C23H26N2O3S2/c1-4-14-25-20-13-12-18(17(2)3)16-21(20)29-23(25)24-22(26)11-8-15-30(27,28)19-9-6-5-7-10-19/h4-7,9-10,12-13,16-17H,1,8,11,14-15H2,2-3H3/b24-23- |
| InChIKey | POBXBRFQDZDIIA-VHXPQNKSSA-N |
| XLogP | 4.69 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|