C22H22N2O5S2 — CID 41087309
4-(4-methylphenyl)sulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)butanamide (PubChem CID 41087309) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)butanamide.
| Compound Name | 4-(4-methylphenyl)sulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)butanamide |
|---|---|
| PubChem CID | 41087309 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(C)cc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C22H22N2O5S2/c1-3-10-24-17-12-18-19(29-14-28-18)13-20(17)30-22(24)23-21(25)5-4-11-31(26,27)16-8-6-15(2)7-9-16/h3,6-9,12-13H,1,4-5,10-11,14H2,2H3/b23-22- |
| InChIKey | NADSSSYODGMJBZ-FCQUAONHSA-N |
| XLogP | 3.61 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|