C19H16N2O3S — CID 40694653
3-methyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide (PubChem CID 40694653) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-methyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide.
| Compound Name | 3-methyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
|---|---|
| PubChem CID | 40694653 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-methyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(C)c2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C19H16N2O3S/c1-3-7-21-14-9-15-16(24-11-23-15)10-17(14)25-19(21)20-18(22)13-6-4-5-12(2)8-13/h3-6,8-10H,1,7,11H2,2H3/b20-19- |
| InChIKey | SWVDHZGONJDCOK-VXPUYCOJSA-N |
| XLogP | 3.67 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|