C22H18N2OS — CID 5054088
N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide (PubChem CID 5054088) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide.
| Compound Name | N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5054088 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc3ccccc3c2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C22H18N2OS/c1-3-12-24-19-11-8-15(2)13-20(19)26-22(24)23-21(25)18-10-9-16-6-4-5-7-17(16)14-18/h3-11,13-14H,1,12H2,2H3/b23-22- |
| InChIKey | IINLYXAOIVSKMK-FCQUAONHSA-N |
| XLogP | 5.09 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|