C21H17N3O2S — CID 43943231
N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 43943231) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 43943231 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3ccccc3)on2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H17N3O2S/c1-3-11-24-17-10-9-14(2)12-19(17)27-21(24)22-20(25)16-13-18(26-23-16)15-7-5-4-6-8-15/h3-10,12-13H,1,11H2,2H3/b22-21- |
| InChIKey | NDIBQIPOLWORJQ-DQRAZIAOSA-N |
| XLogP | 4.59 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|