C20H18N4OS — CID 43943238
2-methyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 43943238) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-methyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43943238 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-methyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2c(C)nc3ccccn23)sc2cc(C)ccc21 |
| InChI | InChI=1S/C20H18N4OS/c1-4-10-23-15-9-8-13(2)12-16(15)26-20(23)22-19(25)18-14(3)21-17-7-5-6-11-24(17)18/h4-9,11-12H,1,10H2,2-3H3/b22-20- |
| InChIKey | NQJSEEJVFCJJRZ-XDOYNYLZSA-N |
| XLogP | 3.89 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|