C20H20N2OS — CID 41016387
N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methylbenzamide (PubChem CID 41016387) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methylbenzamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methylbenzamide |
|---|---|
| PubChem CID | 41016387 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(C)c2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H20N2OS/c1-5-9-22-17-11-14(3)15(4)12-18(17)24-20(22)21-19(23)16-8-6-7-13(2)10-16/h5-8,10-12H,1,9H2,2-4H3/b21-20- |
| InChIKey | VMXYBRUZNKOPKZ-MRCUWXFGSA-N |
| XLogP | 4.56 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|