C20H20N2O3S2 — CID 40697761
N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide (PubChem CID 40697761) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 40697761 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(C)(=O)=O)cc2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H20N2O3S2/c1-5-10-22-17-11-13(2)14(3)12-18(17)26-20(22)21-19(23)15-6-8-16(9-7-15)27(4,24)25/h5-9,11-12H,1,10H2,2-4H3/b21-20- |
| InChIKey | RIKRVRFVBLDQME-MRCUWXFGSA-N |
| XLogP | 3.65 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|