C20H17N3OS2 — CID 41016413
N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide (PubChem CID 41016413) has the molecular formula C20H17N3OS2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 41016413 |
| Molecular Formula | C20H17N3OS2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2nc3ccccc3s2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H17N3OS2/c1-4-9-23-15-10-12(2)13(3)11-17(15)26-20(23)22-18(24)19-21-14-7-5-6-8-16(14)25-19/h4-8,10-11H,1,9H2,2-3H3/b22-20- |
| InChIKey | XRHQRJPRKHZVAI-XDOYNYLZSA-N |
| XLogP | 4.86 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|