C18H11F2N3OS2 — CID 4125840
N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide (PubChem CID 4125840) has the molecular formula C18H11F2N3OS2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 4125840 |
| Molecular Formula | C18H11F2N3OS2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2nc3ccccc3s2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C18H11F2N3OS2/c1-2-7-23-15-11(20)8-10(19)9-14(15)26-18(23)22-16(24)17-21-12-5-3-4-6-13(12)25-17/h2-6,8-9H,1,7H2/b22-18- |
| InChIKey | AKCCPETZEGGTII-PYCFMQQDSA-N |
| XLogP | 4.52 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|