C19H16F2N2OS2 — CID 42523511
2-benzylsulfanyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 42523511) has the molecular formula C19H16F2N2OS2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 42523511 |
| Molecular Formula | C19H16F2N2OS2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-benzylsulfanyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)CSCc2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C19H16F2N2OS2/c1-2-8-23-18-15(21)9-14(20)10-16(18)26-19(23)22-17(24)12-25-11-13-6-4-3-5-7-13/h2-7,9-10H,1,8,11-12H2/b22-19- |
| InChIKey | RNDLXIBBVZWMPE-QOCHGBHMSA-N |
| XLogP | 4.53 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|