C22H24N2OS3 — CID 121055376
4-benzylsulfanyl-N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 121055376) has the molecular formula C22H24N2OS3 and a molecular weight of 428.65 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-benzylsulfanyl-N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 121055376 |
| Molecular Formula | C22H24N2OS3 |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-benzylsulfanyl-N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C22H24N2OS3/c1-3-13-24-19-12-11-18(26-2)15-20(19)28-22(24)23-21(25)10-7-14-27-16-17-8-5-4-6-9-17/h3-6,8-9,11-12,15H,1,7,10,13-14,16H2,2H3/b23-22- |
| InChIKey | OIAUKMGLLBWHEV-FCQUAONHSA-N |
| XLogP | 5.75 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|