C23H26N2OS2 — CID 121055342
4-benzylsulfanyl-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 121055342) has the molecular formula C23H26N2OS2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-benzylsulfanyl-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 121055342 |
| Molecular Formula | C23H26N2OS2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-benzylsulfanyl-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C23H26N2OS2/c1-4-12-25-20-15-17(2)14-18(3)22(20)28-23(25)24-21(26)11-8-13-27-16-19-9-6-5-7-10-19/h4-7,9-10,14-15H,1,8,11-13,16H2,2-3H3/b24-23- |
| InChIKey | KQFAJCBFYAEHNB-VHXPQNKSSA-N |
| XLogP | 5.65 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|