C24H28N2O3S2 — CID 42523578
ethyl 2-[2-(4-benzylsulfanylbutanoylimino)-5,7-dimethyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 42523578) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is ethyl 2-[2-(4-benzylsulfanylbutanoylimino)-5,7-dimethyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-benzylsulfanylbutanoylimino)-5,7-dimethyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 42523578 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | ethyl 2-[2-(4-benzylsulfanylbutanoylimino)-5,7-dimethyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CCCSCc2ccccc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C24H28N2O3S2/c1-4-29-22(28)15-26-20-14-17(2)13-18(3)23(20)31-24(26)25-21(27)11-8-12-30-16-19-9-6-5-7-10-19/h5-7,9-10,13-14H,4,8,11-12,15-16H2,1-3H3/b25-24- |
| InChIKey | WVAQPWUZRCZQTC-IZHYLOQSSA-N |
| XLogP | 5.02 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|