C22H25ClN2O2S2 — CID 42523593
4-benzylsulfanyl-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 42523593) has the molecular formula C22H25ClN2O2S2 and a molecular weight of 449.04 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-benzylsulfanyl-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 42523593 |
| Molecular Formula | C22H25ClN2O2S2 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 4-benzylsulfanyl-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H25ClN2O2S2/c1-2-27-13-12-25-19-11-10-18(23)15-20(19)29-22(25)24-21(26)9-6-14-28-16-17-7-4-3-5-8-17/h3-5,7-8,10-11,15H,2,6,9,12-14,16H2,1H3/b24-22- |
| InChIKey | SMDVTHUIAWOCRX-GYHWCHFESA-N |
| XLogP | 5.53 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|