C25H30N2O3S2 — CID 121055362
methyl 2-[2-(4-benzylsulfanylbutanoylimino)-6-butyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 121055362) has the molecular formula C25H30N2O3S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is methyl 2-[2-(4-benzylsulfanylbutanoylimino)-6-butyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-benzylsulfanylbutanoylimino)-6-butyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 121055362 |
| Molecular Formula | C25H30N2O3S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | methyl 2-[2-(4-benzylsulfanylbutanoylimino)-6-butyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCc1ccc2c(c1)s/c(=N\C(=O)CCCSCc1ccccc1)n2CC(=O)OC |
| InChI | InChI=1S/C25H30N2O3S2/c1-3-4-9-19-13-14-21-22(16-19)32-25(27(21)17-24(29)30-2)26-23(28)12-8-15-31-18-20-10-6-5-7-11-20/h5-7,10-11,13-14,16H,3-4,8-9,12,15,17-18H2,1-2H3/b26-25- |
| InChIKey | CVOFIFKGRYDEGZ-QPLCGJKRSA-N |
| XLogP | 5.36 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|