C20H19FN2O3S2 — CID 25406084
methyl 2-[6-fluoro-2-(4-phenylsulfanylbutanoylimino)-1,3-benzothiazol-3-yl]acetate (PubChem CID 25406084) has the molecular formula C20H19FN2O3S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is methyl 2-[6-fluoro-2-(4-phenylsulfanylbutanoylimino)-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[6-fluoro-2-(4-phenylsulfanylbutanoylimino)-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406084 |
| Molecular Formula | C20H19FN2O3S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | methyl 2-[6-fluoro-2-(4-phenylsulfanylbutanoylimino)-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C20H19FN2O3S2/c1-26-19(25)13-23-16-10-9-14(21)12-17(16)28-20(23)22-18(24)8-5-11-27-15-6-3-2-4-7-15/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3/b22-20- |
| InChIKey | ALNHXTDBWABEOX-XDOYNYLZSA-N |
| XLogP | 4.01 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|