C23H24N2O5S2 — CID 41086243
methyl 3-(2-methoxy-2-oxoethyl)-2-[4-(4-methylphenyl)sulfanylbutanoylimino]-1,3-benzothiazole-6-carboxylate (PubChem CID 41086243) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is methyl 3-(2-methoxy-2-oxoethyl)-2-[4-(4-methylphenyl)sulfanylbutanoylimino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-methoxy-2-oxoethyl)-2-[4-(4-methylphenyl)sulfanylbutanoylimino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 41086243 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | methyl 3-(2-methoxy-2-oxoethyl)-2-[4-(4-methylphenyl)sulfanylbutanoylimino]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccc(C)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C23H24N2O5S2/c1-15-6-9-17(10-7-15)31-12-4-5-20(26)24-23-25(14-21(27)29-2)18-11-8-16(22(28)30-3)13-19(18)32-23/h6-11,13H,4-5,12,14H2,1-3H3/b24-23- |
| InChIKey | ZAEXINJXSPTRBO-VHXPQNKSSA-N |
| XLogP | 3.97 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|