C23H26N2O4S3 — CID 41086683
ethyl 2-[2-[4-(4-methoxyphenyl)sulfanylbutanoylimino]-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 41086683) has the molecular formula C23H26N2O4S3 and a molecular weight of 490.67 g/mol. Its IUPAC name is ethyl 2-[2-[4-(4-methoxyphenyl)sulfanylbutanoylimino]-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(4-methoxyphenyl)sulfanylbutanoylimino]-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41086683 |
| Molecular Formula | C23H26N2O4S3 |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | ethyl 2-[2-[4-(4-methoxyphenyl)sulfanylbutanoylimino]-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CCCSc2ccc(OC)cc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C23H26N2O4S3/c1-4-29-22(27)15-25-19-12-11-18(30-3)14-20(19)32-23(25)24-21(26)6-5-13-31-17-9-7-16(28-2)8-10-17/h7-12,14H,4-6,13,15H2,1-3H3/b24-23- |
| InChIKey | CLNMGBOMLDLPTG-VHXPQNKSSA-N |
| XLogP | 5.00 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|