C23H24N2O5S2 — CID 25406164
ethyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate (PubChem CID 25406164) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406164 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | ethyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C23H24N2O5S2/c1-2-28-22(27)15-25-17-13-18-19(30-11-10-29-18)14-20(17)32-23(25)24-21(26)9-6-12-31-16-7-4-3-5-8-16/h3-5,7-8,13-14H,2,6,9-12,15H2,1H3/b24-23- |
| InChIKey | DHOTYTKODOOBLL-VHXPQNKSSA-N |
| XLogP | 4.04 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|