C20H20N2O3S2 — CID 25406147
N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-4-phenylsulfanylbutanamide (PubChem CID 25406147) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-4-phenylsulfanylbutanamide.
| Compound Name | N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 25406147 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-4-phenylsulfanylbutanamide |
| SMILES | CCn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H20N2O3S2/c1-2-22-15-11-16-17(25-13-24-16)12-18(15)27-20(22)21-19(23)9-6-10-26-14-7-4-3-5-8-14/h3-5,7-8,11-12H,2,6,9-10,13H2,1H3/b21-20- |
| InChIKey | KHXMJNBHCKDPFU-MRCUWXFGSA-N |
| XLogP | 4.45 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|