C22H22N2O5S2 — CID 25406163
methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate (PubChem CID 25406163) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406163 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C22H22N2O5S2/c1-27-21(26)14-24-16-12-17-18(29-10-9-28-17)13-19(16)31-22(24)23-20(25)8-5-11-30-15-6-3-2-4-7-15/h2-4,6-7,12-13H,5,8-11,14H2,1H3/b23-22- |
| InChIKey | RBGZRJXISSXTAE-FCQUAONHSA-N |
| XLogP | 3.65 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|