C20H21N3O5S3 — CID 16805793
methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 16805793) has the molecular formula C20H21N3O5S3 and a molecular weight of 479.61 g/mol. Its IUPAC name is methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16805793 |
| Molecular Formula | C20H21N3O5S3 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | methyl 2-[2-(4-phenylsulfanylbutanoylimino)-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H21N3O5S3/c1-28-19(25)13-23-16-10-9-15(31(21,26)27)12-17(16)30-20(23)22-18(24)8-5-11-29-14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H2,21,26,27)/b22-20- |
| InChIKey | DNJWJOOHXBLEMV-XDOYNYLZSA-N |
| XLogP | 2.52 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|