C21H21ClN2O5S3 — CID 25406721
methyl 2-[2-[4-(4-chlorophenyl)sulfanylbutanoylimino]-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 25406721) has the molecular formula C21H21ClN2O5S3 and a molecular weight of 513.06 g/mol. Its IUPAC name is methyl 2-[2-[4-(4-chlorophenyl)sulfanylbutanoylimino]-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[4-(4-chlorophenyl)sulfanylbutanoylimino]-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406721 |
| Molecular Formula | C21H21ClN2O5S3 |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | methyl 2-[2-[4-(4-chlorophenyl)sulfanylbutanoylimino]-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccc(Cl)cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H21ClN2O5S3/c1-29-20(26)13-24-17-10-9-16(32(2,27)28)12-18(17)31-21(24)23-19(25)4-3-11-30-15-7-5-14(22)6-8-15/h5-10,12H,3-4,11,13H2,1-2H3/b23-21- |
| InChIKey | SDGQIOYUBUSWAU-LNVKXUELSA-N |
| XLogP | 3.93 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|