C20H18ClFN2O3S2 — CID 25406532
methyl 2-[6-chloro-2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-1,3-benzothiazol-3-yl]acetate (PubChem CID 25406532) has the molecular formula C20H18ClFN2O3S2 and a molecular weight of 452.96 g/mol. Its IUPAC name is methyl 2-[6-chloro-2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[6-chloro-2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406532 |
| Molecular Formula | C20H18ClFN2O3S2 |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | methyl 2-[6-chloro-2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCCSc2ccc(F)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18ClFN2O3S2/c1-27-19(26)12-24-16-9-4-13(21)11-17(16)29-20(24)23-18(25)3-2-10-28-15-7-5-14(22)6-8-15/h4-9,11H,2-3,10,12H2,1H3/b23-20- |
| InChIKey | OHMYVMSONDOAQZ-ATJXCDBQSA-N |
| XLogP | 4.67 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|