C21H23ClN2OS3 — CID 30680274
N-[6-chloro-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide (PubChem CID 30680274) has the molecular formula C21H23ClN2OS3 and a molecular weight of 451.08 g/mol. Its IUPAC name is N-[6-chloro-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide.
| Compound Name | N-[6-chloro-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 30680274 |
| Molecular Formula | C21H23ClN2OS3 |
| Molecular Weight | 451.08 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[6-chloro-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide |
| SMILES | CSCCn1/c(=N/C(=O)CCCSc2ccc(C)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H23ClN2OS3/c1-15-5-8-17(9-6-15)27-12-3-4-20(25)23-21-24(11-13-26-2)18-10-7-16(22)14-19(18)28-21/h5-10,14H,3-4,11-13H2,1-2H3/b23-21- |
| InChIKey | BTLYITRXJIVFSC-LNVKXUELSA-N |
| XLogP | 6.03 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|