C21H23FN2OS3 — CID 41124867
4-(4-fluorophenyl)sulfanyl-N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 41124867) has the molecular formula C21H23FN2OS3 and a molecular weight of 434.63 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 41124867 |
| Molecular Formula | C21H23FN2OS3 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CSCCn1/c(=N/C(=O)CCCSc2ccc(F)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H23FN2OS3/c1-15-5-10-18-19(14-15)28-21(24(18)11-13-26-2)23-20(25)4-3-12-27-17-8-6-16(22)7-9-17/h5-10,14H,3-4,11-13H2,1-2H3/b23-21- |
| InChIKey | DKZWSWMBYFXGIB-LNVKXUELSA-N |
| XLogP | 5.51 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|