C22H26N2O2S2 — CID 41086225
N-[3-(2-methoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide (PubChem CID 41086225) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide.
| Compound Name | N-[3-(2-methoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086225 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[3-(2-methoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfanylbutanamide |
| SMILES | COCCn1/c(=N/C(=O)CCCSc2ccc(C)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C22H26N2O2S2/c1-16-6-9-18(10-7-16)27-14-4-5-21(25)23-22-24(12-13-26-3)19-11-8-17(2)15-20(19)28-22/h6-11,15H,4-5,12-14H2,1-3H3/b23-22- |
| InChIKey | RSOHHBYXBVWQRX-FCQUAONHSA-N |
| XLogP | 4.97 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|