C20H21ClN2O2S2 — CID 25406021
N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide (PubChem CID 25406021) has the molecular formula C20H21ClN2O2S2 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide.
| Compound Name | N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 25406021 |
| Molecular Formula | C20H21ClN2O2S2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide |
| SMILES | COCCn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H21ClN2O2S2/c1-25-12-11-23-17-10-9-15(21)14-18(17)27-20(23)22-19(24)8-5-13-26-16-6-3-2-4-7-16/h2-4,6-7,9-10,14H,5,8,11-13H2,1H3/b22-20- |
| InChIKey | OMTRWOUUQLMEAM-XDOYNYLZSA-N |
| XLogP | 5.00 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|