C22H26N2O2S3 — CID 42523658
4-benzylsulfanyl-N-[3-(2-methoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 42523658) has the molecular formula C22H26N2O2S3 and a molecular weight of 446.66 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[3-(2-methoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-benzylsulfanyl-N-[3-(2-methoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 42523658 |
| Molecular Formula | C22H26N2O2S3 |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-benzylsulfanyl-N-[3-(2-methoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | COCCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C22H26N2O2S3/c1-26-13-12-24-19-11-10-18(27-2)15-20(19)29-22(24)23-21(25)9-6-14-28-16-17-7-4-3-5-8-17/h3-5,7-8,10-11,15H,6,9,12-14,16H2,1-2H3/b23-22- |
| InChIKey | WRQZWTLSMBHVOW-FCQUAONHSA-N |
| XLogP | 5.21 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|