C23H28N2OS3 — CID 121055381
4-benzylsulfanyl-N-[5,6-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 121055381) has the molecular formula C23H28N2OS3 and a molecular weight of 444.69 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[5,6-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-benzylsulfanyl-N-[5,6-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 121055381 |
| Molecular Formula | C23H28N2OS3 |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-benzylsulfanyl-N-[5,6-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CSCCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C23H28N2OS3/c1-17-14-20-21(15-18(17)2)29-23(25(20)11-13-27-3)24-22(26)10-7-12-28-16-19-8-5-4-6-9-19/h4-6,8-9,14-15H,7,10-13,16H2,1-3H3/b24-23- |
| InChIKey | NUXQAQRCXCMURW-VHXPQNKSSA-N |
| XLogP | 5.82 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|