C24H30N2O2S2 — CID 121055339
4-benzylsulfanyl-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 121055339) has the molecular formula C24H30N2O2S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-benzylsulfanyl-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 121055339 |
| Molecular Formula | C24H30N2O2S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-benzylsulfanyl-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCSCc2ccccc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C24H30N2O2S2/c1-4-28-13-12-26-21-16-18(2)15-19(3)23(21)30-24(26)25-22(27)11-8-14-29-17-20-9-6-5-7-10-20/h5-7,9-10,15-16H,4,8,11-14,17H2,1-3H3/b25-24- |
| InChIKey | MGXKYEOMKODEAQ-IZHYLOQSSA-N |
| XLogP | 5.50 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|