C24H30N2O4S2 — CID 42558299
4-benzylsulfonyl-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 42558299) has the molecular formula C24H30N2O4S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-benzylsulfonyl-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-benzylsulfonyl-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 42558299 |
| Molecular Formula | C24H30N2O4S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-benzylsulfonyl-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCS(=O)(=O)Cc2ccccc2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C24H30N2O4S2/c1-4-30-13-12-26-21-15-18(2)19(3)16-22(21)31-24(26)25-23(27)11-8-14-32(28,29)17-20-9-6-5-7-10-20/h5-7,9-10,15-16H,4,8,11-14,17H2,1-3H3/b25-24- |
| InChIKey | XCMVSYIVPSADJA-IZHYLOQSSA-N |
| XLogP | 4.18 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|