C23H26N2O5S2 — CID 42558205
ethyl 2-(4-benzylsulfonylbutanoylimino)-3-ethyl-1,3-benzothiazole-6-carboxylate (PubChem CID 42558205) has the molecular formula C23H26N2O5S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is ethyl 2-(4-benzylsulfonylbutanoylimino)-3-ethyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(4-benzylsulfonylbutanoylimino)-3-ethyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 42558205 |
| Molecular Formula | C23H26N2O5S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | ethyl 2-(4-benzylsulfonylbutanoylimino)-3-ethyl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N\C(=O)CCCS(=O)(=O)Cc1ccccc1)n2CC |
| InChI | InChI=1S/C23H26N2O5S2/c1-3-25-19-13-12-18(22(27)30-4-2)15-20(19)31-23(25)24-21(26)11-8-14-32(28,29)16-17-9-6-5-7-10-17/h5-7,9-10,12-13,15H,3-4,8,11,14,16H2,1-2H3/b24-23- |
| InChIKey | HFQFMMPZFXTQBO-VHXPQNKSSA-N |
| XLogP | 3.72 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |