C16H18N2O6S2 — CID 3495296
ethyl 2-(2-acetylsulfonylacetyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3495296) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 2-(2-acetylsulfonylacetyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(2-acetylsulfonylacetyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3495296 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | ethyl 2-(2-acetylsulfonylacetyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N\C(=O)CS(=O)(=O)C(C)=O)n2CC |
| InChI | InChI=1S/C16H18N2O6S2/c1-4-18-12-7-6-11(15(21)24-5-2)8-13(12)25-16(18)17-14(20)9-26(22,23)10(3)19/h6-8H,4-5,9H2,1-3H3/b17-16- |
| InChIKey | HRXOLMBLRYPHCM-MSUUIHNZSA-N |
| XLogP | 1.29 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|