C19H17FN2O3S — CID 4188249
ethyl 3-ethyl-2-(4-fluorobenzoyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 4188249) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 3-ethyl-2-(4-fluorobenzoyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-ethyl-2-(4-fluorobenzoyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4188249 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | ethyl 3-ethyl-2-(4-fluorobenzoyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N\C(=O)c1ccc(F)cc1)n2CC |
| InChI | InChI=1S/C19H17FN2O3S/c1-3-22-15-10-7-13(18(24)25-4-2)11-16(15)26-19(22)21-17(23)12-5-8-14(20)9-6-12/h5-11H,3-4H2,1-2H3/b21-19- |
| InChIKey | NOQYTVVYCXINGO-VZCXRCSSSA-N |
| XLogP | 3.78 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |