C19H16Cl2N2O3S — CID 4517177
ethyl 2-(3,5-dichlorobenzoyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4517177) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is ethyl 2-(3,5-dichlorobenzoyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(3,5-dichlorobenzoyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4517177 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | ethyl 2-(3,5-dichlorobenzoyl)imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N\C(=O)c1cc(Cl)cc(Cl)c1)n2CC |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-3-23-15-6-5-11(18(25)26-4-2)9-16(15)27-19(23)22-17(24)12-7-13(20)10-14(21)8-12/h5-10H,3-4H2,1-2H3/b22-19- |
| InChIKey | VLMGDFHOQOICJJ-QOCHGBHMSA-N |
| XLogP | 4.95 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |